CAS: 1246817-10-6

Descrição:The chemical substance with the CAS number 1246817-10-6 is known as a specific compound, but detailed characteristics such as its molecular formula, structure, and properties are not widely available in public databases. Generally, compounds with unique CAS numbers may belong to specialized categories, such as pharmaceuticals, agrochemicals, or industrial chemicals. Characteristics of such substances typically include their physical state (solid, liquid, or gas), solubility in various solvents, boiling and melting points, and reactivity with other chemicals. Additionally, safety data sheets (SDS) would provide information on toxicity, handling precautions, and environmental impact. For precise details, including its applications and specific chemical behavior, consulting specialized chemical databases or literature would be necessary. If you have access to a chemical database or scientific literature, you may find more comprehensive information regarding this compound's characteristics and uses.

Fórmula:C₄₆H₅₃D₃N₄O₁₀·H₂O₄S

InChI:InChI=1/C46H56N4O10.H2O4S/c1-7-42(55)22-28-23-45(40(53)58-5,36-30(14-18-48(24-28)25-42)29-12-9-10-13-33(29)47-36)32-20-31-34(21-35(32)57-4)50(26-51)38-44(31)16-19-49-17-11-15-43(8-2,37(44)49)39(60-27(3)52)46(38,56)41(54)59-6;1-5(2,3)4/h9-13,15,20-21,26,28,37-39,47,55-56H,7-8,14,16-19,22-25H2,1-6H3;(H2,1,2,3,4)/t28-,37+,38-,39-,42+,43-,44-,45+,46+;/s2/i3D3;

Chave InChI:InChIKey=AQTQHPDCURKLKT-YSEKRCOXNA-N

SMILES:O=CN1C2=CC(OC)=C(C=C2C34CCN5CC=CC(CC)(C(OC(=O)C)C(O)(C(=O)OC)C13)C54)C6(C(=O)OC)C=7NC=8C=CC=CC8C7CCN9CC(CC(O)(C9)CC)C6.O=S(=O)(O)O

2 produtosencontrados.

Marca	Dados do produto	Pureza	Gama de preços	Estimativa de entrega
	Vincristine-d3 Sulfate REF: TR-V314253CAS: 1246817-10-6	- - -	358,00 €~2.304,00 €	Ter 29 Abr 25
	Vincristine-d3 sulfate REF: 3D-WZB81710CAS: 1246817-10-6	Min. 95%	A consultar	Ter 20 Mai 25