
CAS: 2140301-98-8
Descrição:The chemical substance with the CAS number 2140301-98-8 is known as a specific compound, but detailed information about it may not be widely available in public databases. Generally, compounds are characterized by their molecular structure, functional groups, physical properties (such as melting point, boiling point, and solubility), and chemical reactivity. The characteristics of a chemical substance can also include its applications in various fields, such as pharmaceuticals, agriculture, or materials science. Additionally, safety data, including toxicity and handling precautions, are crucial for understanding how to work with the substance safely. For precise information, including its specific properties and applications, consulting specialized chemical databases or scientific literature is recommended.
Fórmula:C25H36F3N5O3·C4H6O4
InChI:InChI=1S/C25H36F3N5O3.C4H6O4/c1-15(2)24(6-4-16(10-24)31-19-5-7-36-13-20(19)35-3)23(34)33-12-17-8-18(33)11-32(17)22-9-21(25(26,27)28)29-14-30-22;5-3(6)1-2-4(7)8/h9,14-20,31H,4-8,10-13H2,1-3H3;1-2H2,(H,5,6)(H,7,8)/t16-,17+,18+,19+,20-,24+;/m1./s1
Chave InChI:InChIKey=WRPPUEHVLSHXJG-HTQYHTRRSA-N
SMILES:O=C(O)CCC(=O)O.O=C(N1CC2N(C3=NC=NC(=C3)C(F)(F)F)CC1C2)C4(CCC(NC5CCOCC5OC)C4)C(C)C
Marca | Dados do produto | Pureza | Gama de preços | Estimativa de entrega |
---|---|---|---|---|
![]() | Pf-04634817 succinate REF: 3D-QKD30198CAS: 2140301-98-8 | Min. 95% | A consultar | Ter 03 Jun 25 |
![]() | PF-04634817 succinate REF: TM-T12419CAS: 2140301-98-8 | 98% | 1.095,00 €~2.945,00 € | Qua 25 Jun 25 |

Pf-04634817 succinate
Ref: 3D-QKD30198
5mg | 1.033,00 € | ||
10mg | 1.355,00 € | ||
25mg | 2.474,00 € | ||
50mg | 3.958,00 € |

PF-04634817 succinate
Ref: TM-T12419
25mg | 1.730,00 € | ||
50mg | 2.262,00 € | ||
100mg | 2.945,00 € |