CAS 2830-53-7

1-(benzyloxy)-2-bromo-4-methylbenzene

Descrição:

1-(Benzyloxy)-2-bromo-4-methylbenzene, also known by its CAS number 2830-53-7, is an organic compound characterized by its aromatic structure. It features a bromine atom and a benzyloxy group attached to a methyl-substituted benzene ring. The presence of the bromine atom introduces electrophilic reactivity, making it useful in various chemical reactions, such as nucleophilic substitutions. The benzyloxy group enhances the compound's solubility in organic solvents and can participate in further chemical transformations. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Its molecular structure contributes to its physical properties, including melting and boiling points, which are influenced by intermolecular forces such as van der Waals interactions and dipole-dipole interactions. Additionally, 1-(benzyloxy)-2-bromo-4-methylbenzene can be utilized in synthetic organic chemistry for the preparation of more complex molecules, making it a valuable intermediate in pharmaceutical and materials science applications.

Fórmula: C₁₄H₁₃BrO

InChI: InChI=1/C14H13BrO/c1-11-7-8-14(13(15)9-11)16-10-12-5-3-2-4-6-12/h2-9H,10H2,1H3

SMILES: Cc1ccc(c(c1)Br)OCc1ccccc1

Sinónimos:

• Benzene, 2-bromo-4-methyl-1-(phenylmethoxy)-
• Benzyl 2-bromo-4-methylphenyl ether
• 1-Benzyloxy-2-bromo-4-methylbenzene

1-(Benzyloxy)-2-bromo-4-methylbenzene

CAS: 2830-53-7

Fórmula: C₁₄H₁₃BrO

Pureza: 96%

Cor e Forma: Solid

Peso molecular: 277.1564

Ref: IN-DA00BECP

1-(Benzyloxy)-2-bromo-4-methylbenzene

CAS: 2830-53-7

1-(Benzyloxy)-2-bromo-4-methylbenzene

Pureza: 98%

Peso molecular: 277.16g/mol

Ref: 54-OR96106

1-(Benzyloxy)-2-bromo-4-methylbenzene

CAS: 2830-53-7

Fórmula: C₁₄H₁₃BrO

Pureza: 98%

Cor e Forma: Solid

Peso molecular: 277.161

Ref: 10-F218688