CAS 90411-12-4

Neochamaejasmin B

Descrição:

Neochamaejasmin B é um composto químico classificado como um flavonoide, especificamente um tipo de chalcona. É derivado de fontes naturais, frequentemente encontrado em várias plantas, e é conhecido por suas potenciais atividades biológicas. O composto exibe propriedades antioxidantes, que podem contribuir ao seu papel na proteção das células contra o estresse oxidativo. Além disso, Neochamaejasmin B tem sido estudado por seus efeitos anti-inflamatórios e antimicrobianos, tornando-o de interesse na pesquisa farmacológica. Sua estrutura geralmente apresenta uma espinha dorsal de flavonoide característica, que é responsável por suas diversas atividades biológicas. A solubilidade e estabilidade do composto podem variar dependendo do solvente e das condições ambientais, influenciando suas aplicações tanto na pesquisa quanto em contextos terapêuticos potenciais. Assim como muitos produtos naturais, mais estudos são necessários para elucidar completamente seus mecanismos de ação e potenciais benefícios à saúde.

Fórmula: C₃₀H₂₂O₁₀

InChI: InChI=1/C30H22O10/c31-15-5-1-13(2-6-15)29-25(27(37)23-19(35)9-17(33)11-21(23)39-29)26-28(38)24-20(36)10-18(34)12-22(24)40-30(26)14-3-7-16(32)8-4-14/h1-12,25-26,29-36H/t25-,26-,29-,30+/s2

Chave InChI: InChIKey=RNQBLQALVMHBKH-HPZZALBMNA-N

SMILES: O=C1[C@]([C@@H](OC=2C1=C(O)C=C(O)C2)C3=CC=C(O)C=C3)([C@]4([C@H](OC=5C(C4=O)=C(O)C=C(O)C5)C6=CC=C(O)C=C6)[H])[H]

Sinónimos:

• rel-(+)-(2R,2′S,3R,3′R)-2,2′,3,3′-Tetrahydro-5,5′,7,7′-tetrahydroxy-2,2′-bis(4-hydroxyphenyl)[3,3′-bi-4H-1-benzopyran]-4,4′-dione
• (+)-Neochamaejasmin B
• [3,3′-Bi-4H-1-benzopyran]-4,4′-dione, 2,2′,3,3′-tetrahydro-5,5′,7,7′-tetrahydroxy-2,2′-bis(4-hydroxyphenyl)-, [2α,3α(2′S*,3′R*)]-(+)-
• [3,3′-Bi-4H-1-benzopyran]-4,4′-dione, 2,2′,3,3′-tetrahydro-5,5′,7,7′-tetrahydroxy-2,2′-bis(4-hydroxyphenyl)-, (2R,2′S,3R,3′R)-rel-(+)-
• Neochamaejasmin B

Neochamaejasmin B

CAS: 90411-12-4

Fórmula: C₃₀H₂₂O₁₀

Pureza: 98%

Peso molecular: 542.4897

Ref: IN-DA00H3AT

Neochamaejasmine B

CAS: 90411-12-4

Neochamaejasmine B

Pureza: ≥95%

Peso molecular: 542.49g/mol

Ref: 54-BUP01902

Neochamaejasmin B

CAS: 90411-12-4

Fórmula: C₃₀H₂₂O₁₀

Pureza: 95%~99%

Cor e Forma: Powder

Peso molecular: 542.496

Ref: BP-SBP03132

Neochamaejasmine B

CAS: 90411-12-4

Neochamaejasmine B displays nematicidal activity against both Bursaphelenchus xylophilus and Bursaphelenchus mucronatus.

Fórmula: C₃₀H₂₂O₁₀

Pureza: 97.89%

Cor e Forma: Solid

Peso molecular: 542.49

Ref: TM-TN1977

Neochamaejasmine B

CAS: 90411-12-4

Neochamaejasmine B is a natural bioactive compound, which is derived from the roots of Stellera chamaejasme L., a plant found in various regions of Asia. This compound is classified as a flavonoid, known for its diverse range of biological activities. Its mode of action involves interacting with cellular pathways that regulate processes such as inflammation, cell proliferation, and apoptosis. This multifaceted activity makes Neochamaejasmine B an attractive candidate for research into potential therapeutic applications. Studies have highlighted its potential in the treatment of conditions such as cancer, due to its ability to inhibit specific cancer cell lines, as well as its anti-inflammatory properties which could be beneficial in chronic inflammatory diseases. As research advances, further elucidation of its molecular mechanisms and therapeutic efficacy is anticipated, contributing valuable insights into its application in medicinal chemistry and pharmacology.

Fórmula: C₃₀H₂₂O₁₀

Pureza: Min. 95%

Peso molecular: 542.5 g/mol

Ref: 3D-QDA41112