Informação sobre produto
- N-p-n-Hexyloxybenzylidene-p'-n-butylaniline
- 4-butyl-N-{(E)-[4-(hexyloxy)phenyl]methylidene}aniline
p-Hexyloxybenzylidene p-butylaniline is a liquid crystal material with the chemical formula CH3(CH2)5C6H4C6H4CO2C5H5. It belongs to the group of liquid crystals that are isotropic, which means they have no directional properties in their molecular structure. This compound has a transition temperature of around -65°C and a coefficient of thermal expansion of 3.7x10-6 K-1. Its crystallinity is measured at 0%. p-Hexyloxybenzylidene p-butylaniline undergoes a transition from solid to liquid state at a velocity of 5 cm/s and its entropy changes by 7 J/Kmol at this transition point.
Propriedades químicas
Consulta técnica sobre: 3D-EBA74311 p-Hexyloxybenzylidene p-butylaniline
Se desejar solicitar um orçamento ou fazer uma encomenda, por favor, adicione os produtos ao seu carrinho e depois solicite um orçamento ou encomenda a partir do carrinho. É mais rápido, mais barato e poderá beneficiar-se dos descontos e outras vantagens disponíveis.
