Informação sobre produto
Nome:2-Amino-5-methylpyridine
Marca:Biosynth
Descrição:2-Amino-5-methylpyridine is a chemical compound that belongs to the group of methyl ketones. It has a nitrogen atom and an oxygen atom in its structure, which allows it to form hydrogen bonds with other molecules. 2-Amino-5-methylpyridine can be obtained by reacting hydrochloric acid and xanthone in the presence of a base. The compound is highly reactive and has been shown to have antiinflammatory properties. This can be attributed to its ability to inhibit prostaglandin synthesis. 2-Amino-5-methylpyridine also has fluorescence properties that are sensitive to pH changes and can be used as a probe for metal ions.
2-Amino-5-methylpyridine is an organic compound that contains a methyl group, two nitrogen atoms, and one oxygen atom in its chemical structure. This molecule can form hydrogen bonds with other molecules due to its nitrogen atoms and oxygen atom,
2-Amino-5-methylpyridine is an organic compound that contains a methyl group, two nitrogen atoms, and one oxygen atom in its chemical structure. This molecule can form hydrogen bonds with other molecules due to its nitrogen atoms and oxygen atom,
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:108.14 g/mol
Fórmula:C6H8N2
Pureza:Min. 95%
Cor/forma:Powder
InChI:InChI=1S/C6H8N2/c1-5-2-3-6(7)8-4-5/h2-4H,1H3,(H2,7,8)
Chave InChI:InChIKey=CMBSSVKZOPZBKW-UHFFFAOYSA-N
SMILES:Cc1ccc(N)nc1
Consulta técnica sobre 2-Amino-5-methylpyridine
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda. Se desejar solicitar um orçamento ou fazer uma encomenda, por favor, adicione os produtos ao seu carrinho e depois solicite um orçamento ou encomenda a partir do carrinho. É mais rápido, mais barato e poderá beneficiar-se dos descontos e outras vantagens disponíveis.
