
Acid blue 62
CAS:
Ref. 3D-FA165997

Informação sobre produto
Nome:Acid blue 62
Marca:Biosynth
Descrição:Acid blue 62 is a reactive dye that is used in the treatment of wastewater. It is used as a chemical intermediate to produce other dyes and as an ingredient in detergent compositions. Acid blue 62 has been shown to have genotoxic effects and may cause cancer. The potential for acid blue 62 to cause cancer is based on its chemical structure and its ability to form reactive metabolites with DNA, which can lead to the formation of DNA adducts. Acid blue 62 also has the ability to bind strongly to surfaces, which can lead to the formation of particulates or aggregates. The surface methodology suggests that the adsorption process follows a Langmuir adsorption isotherm. This means that there are two equilibrium constants, K1 and K2, where K1 > K2. The higher value of K1 indicates that adsorption will occur at low concentrations while high concentrations will cause desorption. This means that the particle size will increase with increasing concentration until it reaches
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:423.44 g/mol
Fórmula:C20H20N2O5S•Na
Cor/forma:Powder
InChI:InChI=1S/C20H20N2O5S/c21-18-15(28(25,26)27)10-14(22-11-6-2-1-3-7-11)16-17(18)20(24)13-9-5-4-8-12(13)19(16)23/h4-5,8-11,22H,1-3,6-7,21H2,(H,25,26,27)
Chave InChI:InChIKey=GMBNNHLANOGOAU-UHFFFAOYSA-N
SMILES:Nc1c(S(=O)(=O)O)cc(NC2CCCCC2)c2c1C(=O)c1ccccc1C2=O