
4-Aminopyridine N-oxide
CAS:
Ref. 3D-FA17842

Informação sobre produto
Nome:4-Aminopyridine N-oxide
Sinónimos:
- 4-Pyridinamine 1-oxide4-Aminopyridine 1-oxideNSC 351983
Marca:Biosynth
Descrição:4-Aminopyridine N-oxide is a white, crystalline solid that is soluble in water and alcohol. It has a molecular weight of 128.2 and formula weight of 135.2. 4-Aminopyridine N-oxide reacts with acid solutions to produce nitrous acid and ammonia gas. The rate of the reaction depends on the concentration of aminopyridine and aniline, as well as the pH of the solution. The acetylation, diazotisation, and kinetics have also been studied extensively for this compound. Nitrous acid can react with amides to form azulene, which can then react with amines to form a molecule containing nitrogen, oxygen, carbon, hydrogen and one other element or compound from each group (e.g., NHCOCH). This reaction is reversible when solvents are present.br> 4-Aminopyridine N-oxide may be used as a precursor for other organic
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:110.11 g/mol
Fórmula:C5H6N2O
Pureza:Min. 95%
Cor/forma:Slightly Yellow Powder
InChI:InChI=1S/C5H6N2O/c6-5-1-3-7(8)4-2-5/h1-4,6,8H
Chave InChI:InChIKey=SJQWWHFNDOUAGY-UHFFFAOYSA-N
SMILES:N=c1ccn(O)cc1