Informação sobre produto
Nome:2-Amino-4-bromobenzoic acid
Marca:Biosynth
Descrição:2-Amino-4-bromobenzoic acid is a molecule that has an acidic carboxylic group and two aromatic amino groups. It has a hydroxyl group and a fluorescence that can be activated or deactivated by ultraviolet light. 2-Amino-4-bromobenzoic acid is used in the synthesis of certain organic compounds. This molecule can be synthesized from other molecules, such as phenol, aminobenzene, and nitrobenzene. The reaction time for this chemical species is dependent on the catalytic agent used during the reaction process. A variety of chemical species are produced when 2-Amino-4-bromobenzoic acid is synthesized, including hydrogen bromide, ammonia, nitrogen gas, and water vapor. The population of 2-Amino-4-bromobenzoic acid is unknown because it is not abundant in nature.
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:216.03 g/mol
Fórmula:C7H6BrNO2
Pureza:Min. 95%
Cor/forma:Yellow Powder
InChI:InChI=1S/C7H6BrNO2/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3H,9H2,(H,10,11)
Chave InChI:InChIKey=BNNICQAVXPXQAH-UHFFFAOYSA-N
SMILES:Nc1cc(Br)ccc1C(=O)O
Consulta técnica sobre 2-Amino-4-bromobenzoic acid
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda. Se desejar solicitar um orçamento ou fazer uma encomenda, por favor, adicione os produtos ao seu carrinho e depois solicite um orçamento ou encomenda a partir do carrinho. É mais rápido, mais barato e poderá beneficiar-se dos descontos e outras vantagens disponíveis.