

Informação sobre produto
Nome:N-Benzyl-N-isopropylamine
Marca:Biosynth
Descrição:N-Benzyl-N-isopropylamine is a divalent hydrocarbon that is soluble in water and has a high melting point. It is an acid with a pK of 4.5, and its conjugate base has a pK of 8.4. N-Benzyl-N-isopropylamine can be synthesized by reacting benzaldehyde with isopropyl amine in the presence of sodium hydroxide, or by heating benzaldehyde with sodium hydroxide and methyl propiolate to make the corresponding nitro compound, which is then reduced with hydrogen gas to make the final product. It reacts with strong acids such as hydrochloric acid or sodium hydroxide solution to produce an aldimine, which can then react with nucleophiles such as hydroxide ion (OH-) or ammonia (NH3) to form an imine.
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:149.23 g/mol
Fórmula:C10H15N
Pureza:Min. 95%
InChI:InChI=1S/C10H15N/c1-9(2)11-8-10-6-4-3-5-7-10/h3-7,9,11H,8H2,1-2H3
Chave InChI:InChIKey=LYBKPDDZTNUNNM-UHFFFAOYSA-N
SMILES:CC(C)NCc1ccccc1