Informação sobre produto
Nome:Butyl lactate
Sinónimos:
- Butyl 2-HydroxypropionateLactic Acid Butyl Ester
Marca:Biosynth
Descrição:Butyl lactate is a colorless liquid that is used in the synthesis of other chemicals, including plasticizers and lubricants. It has a basic structure with a hydroxyl group attached to an ester group. Butyl lactate can be synthesized by reacting butanol with lactic acid or sodium lactate in the presence of a catalyst such as zirconium oxide, aluminum chloride, or sodium hydroxide. The bioavailability of this compound is low due to its high molecular weight and low solubility in water. Nitro groups are often added to butyl lactates to improve their solubility in organic solvents.
Butyl lactate is synthesized by the reaction of butanol with lactic acid or sodium lactate in the presence of a catalyst such as zirconium oxide, aluminum chloride, or sodium hydroxide. The bioavailability of this compound is low due to its high molecular weight and low solubility in water
Butyl lactate is synthesized by the reaction of butanol with lactic acid or sodium lactate in the presence of a catalyst such as zirconium oxide, aluminum chloride, or sodium hydroxide. The bioavailability of this compound is low due to its high molecular weight and low solubility in water
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:146.18 g/mol
Fórmula:C7H14O3
Pureza:Min. 95%
InChI:InChI=1S/C7H14O3/c1-3-4-5-10-7(9)6(2)8/h6,8H,3-5H2,1-2H3
Chave InChI:InChIKey=MRABAEUHTLLEML-UHFFFAOYSA-N
SMILES:CCCCOC(=O)C(C)O