Informação sobre produto
Nome:3-(2-Bromoacetyl)-2H-chromen-2-one
Sinónimos:
- 3-(ω-Bromoacetyl)coumarin
Marca:Biosynth
Descrição:3-(2-Bromoacetyl)-2H-chromen-2-one is a compound that has been shown to inhibit the growth of human liver cancer cells and has been used in the treatment of some cancers. 3-(2-Bromoacetyl)-2H-chromen-2-one is a nucleophile, which reacts with electrophiles, such as 2Nal, to form an intermediate covalent bond. The reaction mechanism for this process involves a nucleophilic substitution reaction, where one atom (the nucleophile) attacks another atom (the electrophile) from the side opposite its electron cloud. This process results in the formation of a covalent bond between the two atoms and the release of water. 3-(2-Bromoacetyl)-2H-chromen-2one was found to be effective against Streptococcus faecalis and other bacteria after being tested in vitro with these organisms. In addition to being
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:267.08 g/mol
Fórmula:C11H7BrO3
Pureza:Min. 95%
Cor/forma:Powder
InChI:InChI=1S/C11H7BrO3/c12-6-9(13)8-5-7-3-1-2-4-10(7)15-11(8)14/h1-5H,6H2
Chave InChI:InChIKey=NTYOLVNSXVYRTJ-UHFFFAOYSA-N
SMILES:O=C(CBr)c1cc2ccccc2oc1=O
Consulta técnica sobre 3-(2-Bromoacetyl)-2H-chromen-2-one
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda. Se desejar solicitar um orçamento ou fazer uma encomenda, por favor, adicione os produtos ao seu carrinho e depois solicite um orçamento ou encomenda a partir do carrinho. É mais rápido, mais barato e poderá beneficiar-se dos descontos e outras vantagens disponíveis.