

Informação sobre produto
Nome:Boc-D-pyroglutamic acid
Sinónimos:
- Boc-D-Pyr-OH
Marca:Biosynth
Descrição:Boc-D-pyroglutamic acid is a potassium salt of pyrrolidone-2-carboxylic acid. It is a lactam, which means that it has a cyclic amide group. The structure of this compound is similar to the amino acid glycine and its derivatives. Boc-D-pyroglutamic acid is an enzyme catalyst that takes part in reduction reactions and catalyzes the conversion of aldehydes, ketones, carboxylic acids, and other compounds into alcohols. This chemical can be used as an intermediate for the synthesis of many organic compounds, such as pharmaceuticals or agrochemicals. Boc-D-pyroglutamic acid also has properties that make it useful for chemoenzymatic syntheses, such as its ability to form reactive intermediates with tertiary amines or alkynes.
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:229.23 g/mol
Fórmula:C10H15NO5
Pureza:Min. 95%
InChI:InChI=1S/C10H15NO5/c1-10(2,3)16-9(15)11-6(8(13)14)4-5-7(11)12/h6H,4-5H2,1-3H3,(H,13,14)/t6-/m1/s1
Chave InChI:InChIKey=MJLQPFJGZTYCMH-ZCFIWIBFSA-N
SMILES:CC(C)(C)OC(=O)N1C(=O)CC[C@@H]1C(=O)O