

Informação sobre produto
Nome:2-Bromo-4-fluorophenol
Marca:Biosynth
Descrição:2-Bromo-4-fluorophenol is a biodegradable compound that is used as an intermediate in the manufacture of other chemicals. 2-Bromo-4-fluorophenol has been shown to be carcinogenic and has been linked with phenolic compounds that can lead to DNA damage. This chemical is also known for its antibacterial activity, which may be due to its ability to inhibit bacterial cell wall synthesis. The reaction time for 2-bromo-4-fluorophenol is between 12 and 24 hours, depending on the concentration.
2-Bromo-4-fluorophenol also has the ability to mineralize, which means that it breaks down into oxygen gas and water.
2-Bromo-4-fluorophenol also has the ability to mineralize, which means that it breaks down into oxygen gas and water.
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:191 g/mol
Fórmula:C6H4BrFO
Pureza:Min. 95%
Cor/forma:Clear Liquid
InChI:InChI=1S/C6H4BrFO/c7-5-3-4(8)1-2-6(5)9/h1-3,9H
Chave InChI:InChIKey=MEYRABVEYCFHHB-UHFFFAOYSA-N
SMILES:Oc1ccc(F)cc1Br