

Informação sobre produto
Nome:5-Bromo-3-fluoro-2-hydroxybenzaldehyde
Sinónimos:
- 5-Bromo-3-fluorosalicylaldehyde
Marca:Biosynth
Descrição:5-Bromo-3-fluoro-2-hydroxybenzaldehyde is a functional group that contains nitrogen atoms. It is a copper complex that can be synthesized by the reaction of phenylmagnesium bromide and 5-bromo-3-hydroxybenzaldehyde. This functional group can be used to study the effect of transition metal ions on antibacterial activity. The stability of the complexes is dependent on the tetradentate structure, which means it has four nitrogen atoms that have two hydrogen bonds with the copper ion in order to form a stable complex. These complexes are also known to be diaminodiphenyls, meaning they contain two nitrogen atoms and two methyl groups. The vibrational spectra for this functional group can be obtained using techniques such as infrared spectroscopy and nuclear magnetic resonance spectroscopy. This functional group is found in organisms such as bacteria and yeast. Hydrogen bonding may occur between this functional group and other substances
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:219.01 g/mol
Fórmula:C7H4BrFO2
Pureza:Min. 95%
InChI:InChI=1S/C7H4BrFO2/c8-5-1-4(3-10)7(11)6(9)2-5/h1-3,11H
Chave InChI:InChIKey=YYCQXIWKIRQWHN-UHFFFAOYSA-N
SMILES:O=Cc1cc(Br)cc(F)c1O