Informação sobre produto
Nome:3-Bromobenzamide
Marca:Biosynth
Descrição:3-Bromobenzamide is an amide compound, which is a functional group. It has a molecular weight of 273.3 g/mol and three amine groups. The 3-methoxybenzamide moiety in the molecule can be protonated, which provides the hydration of the molecule and increases its solubility in water. This molecule also has a dipole moment due to the presence of two amide groups.
The synthesis of 3-bromobenzamide starts with the reaction between 3-aminobenzoic acid and benzoyl chloride to form 3-benzoyloxybenzoic acid. This is then reacted with ammonia to form 3-aminobenzamide. Finally this is converted into 3-bromobenzamide by reacting it with bromine in the presence of potassium carbonate as a catalyst.
This molecule is used as an inhibitory compound for mammalian cell proliferation, specifically for cancer cells
The synthesis of 3-bromobenzamide starts with the reaction between 3-aminobenzoic acid and benzoyl chloride to form 3-benzoyloxybenzoic acid. This is then reacted with ammonia to form 3-aminobenzamide. Finally this is converted into 3-bromobenzamide by reacting it with bromine in the presence of potassium carbonate as a catalyst.
This molecule is used as an inhibitory compound for mammalian cell proliferation, specifically for cancer cells
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:200.03 g/mol
Fórmula:C7H6BrNO
Pureza:Min. 95%
Cor/forma:Powder
InChI:InChI=1S/C7H6BrNO/c8-6-3-1-2-5(4-6)7(9)10/h1-4H,(H2,9,10)
Chave InChI:InChIKey=ODJFDWIECLJWSR-UHFFFAOYSA-N
SMILES:NC(=O)c1cccc(Br)c1
Consulta técnica sobre 3-Bromobenzamide
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda. Se desejar solicitar um orçamento ou fazer uma encomenda, por favor, adicione os produtos ao seu carrinho e depois solicite um orçamento ou encomenda a partir do carrinho. É mais rápido, mais barato e poderá beneficiar-se dos descontos e outras vantagens disponíveis.
