Informação sobre produto
Nome:5-Bromo-2-methoxytoluene
Sinónimos:
- 4-Bromo-1-methoxy-2-methylbenzene
Marca:Biosynth
Descrição:5-Bromo-2-methoxytoluene is a bromoarene that reacts to form aziridines and phosphotungstic acid. It is used in the synthesis of polyaromatic compounds with steric interactions. 5-Bromo-2-methoxytoluene is also a functional group that can be used as an allosteric modulator. This compound also has stereoisomers that are chiral, meaning they have different structures despite being mirror images of each other. The carbonyl group on the 5-bromo compound is polar, which means it has a charge. The hydrogen bonds between this compound and other molecules are nonpolar, which means they do not have a charge and are more likely to form in a nonpolar solvent.
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:201.06 g/mol
Fórmula:C8H9BrO
Pureza:Min. 95%
Cor/forma:Powder
InChI:InChI=1S/C8H9BrO/c1-6-5-7(9)3-4-8(6)10-2/h3-5H,1-2H3
Chave InChI:InChIKey=UDLRGQOHGYWLCS-UHFFFAOYSA-N
SMILES:COc1ccc(Br)cc1C
Consulta técnica sobre 5-Bromo-2-methoxytoluene
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda. Se desejar solicitar um orçamento ou fazer uma encomenda, por favor, adicione os produtos ao seu carrinho e depois solicite um orçamento ou encomenda a partir do carrinho. É mais rápido, mais barato e poderá beneficiar-se dos descontos e outras vantagens disponíveis.