

Informação sobre produto
Nome:2-Chlorocyclopentanone
Marca:Biosynth
Descrição:2-Chlorocyclopentanone is a cyclic ketone that is obtained by the reaction of phosphorus pentachloride with cyclopentene oxide. The molecule has been determined by x-ray crystal structures to have a chiral center and reacts with hydrogen chloride to form a mixture of products, one of which is 2-chlorocyclopentanone hydrochloride. 2-Chlorocyclopentanone hydrochloride can be used as an intermediate in the synthesis of phosphites and chlorinated compounds. This compound also has growth factor properties that are due to its ability to activate tumor necrosis factor-α production, causing cell death. 2-Chlorocyclopentanone hydrochloride also has an inhibitory effect on the enzyme xanthine oxidase, which plays a key role in the production of uric acid.
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:118.56 g/mol
Fórmula:C5H7ClO
Pureza:Min. 95%
InChI:InChI=1S/C5H7ClO/c6-4-2-1-3-5(4)7/h4H,1-3H2
Chave InChI:InChIKey=AXDZFGRFZOQVBV-UHFFFAOYSA-N
SMILES:O=C1CCCC1Cl