Informação sobre produto
Nome:Calix[4]arene
Sinónimos:
- Tetrahydroxycalix[4]areneCalix[4]arene-25,26,27,28-tetrol
Marca:Biosynth
Descrição:Calix[4]arenes are a group of aromatic compounds that can be used as optical sensors. They are characterized by the presence of four phenyl rings and an open cavity that is accessible to solvent molecules. The calix[4]arene molecule has two free electron pairs, which makes it possible for the molecule to form stable complexes with various test samples, such as hydrochloric acid, ammonia, and nitric acid. Calix[4]arenes also have linear calibration curves that can be used to measure concentrations of test samples. When heated in the presence of oxygen and water, calix[4]arenes will emit light at a wavelength between 500-600 nm. This light emission is due to an intramolecular hydrogen bond that is formed from the nitrogen atom on one ring to the oxygen atom on another ring.
Calix[4]arenes are also capable of transferring electrons from one ring to another through steric interactions. This process leads to light
Calix[4]arenes are also capable of transferring electrons from one ring to another through steric interactions. This process leads to light
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:424.49 g/mol
Fórmula:C28H24O4
Pureza:Min. 98 Area-%
Cor/forma:White Powder
InChI:InChI=1S/C28H24O4/c29-25-17-5-1-6-18(25)14-20-8-3-10-22(27(20)31)16-24-12-4-11-23(28(24)32)15-21-9-2-7-19(13-17)26(21)30/h1-12,29-32H,13-16H2
Chave InChI:InChIKey=YPNHVQZZPXPQOS-UHFFFAOYSA-N
SMILES:Oc1c2cccc1Cc1cccc(c1O)Cc1cccc(c1O)Cc1cccc(c1O)C2
Consulta técnica sobre Calix[4]arene
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda. Se desejar solicitar um orçamento ou fazer uma encomenda, por favor, adicione os produtos ao seu carrinho e depois solicite um orçamento ou encomenda a partir do carrinho. É mais rápido, mais barato e poderá beneficiar-se dos descontos e outras vantagens disponíveis.
