

Informação sobre produto
Nome:2-Chloro-4'-fluoroacetophenone
Marca:Biosynth
Descrição:2-Chloro-4'-fluoroacetophenone is a chemical that is used as a dehydrating agent in organic synthesis. It is also used for the synthesis of trifluoromethylthiolation products and has been shown to be an important reagent for removing chlorinated organic compounds from wastewater. This compound has been found to react with nucleophilic compounds, such as chloride, by forming the corresponding 2-chloro-4'-fluoroacetophenone chloride in high yield. The reaction time and temperature are determined by the desired product. The mechanism of this reaction involves formation of a dihedral intermediate with fluorine acting as the nucleophile. 2-Chloro-4'-fluoroacetophenone can be synthesized biologically by microorganisms such as Bacillus subtilis.
2-Chloro-4'-fluoroacetophenone is an important precursor molecule in biomolecular research because it can be used to produce fluoroac
2-Chloro-4'-fluoroacetophenone is an important precursor molecule in biomolecular research because it can be used to produce fluoroac
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:172.58 g/mol
Fórmula:C8H6ClFO
Pureza:Min. 95%
InChI:InChI=1S/C8H6ClFO/c9-5-8(11)6-1-3-7(10)4-2-6/h1-4H,5H2
Chave InChI:InChIKey=UJZWJOQRSMOFMA-UHFFFAOYSA-N
SMILES:O=C(CCl)c1ccc(F)cc1