Informação sobre produto
Nome:3-Carboxypropanesulfonamide
Sinónimos:
- 4-Sulfamoylbutyric acid
Marca:Biosynth
Descrição:3-Carboxypropanesulfonamide is a chemical compound that has been shown to have the ability to modulate cardiac cell function. This compound has been shown to be effective in a reaction monitoring technique, which monitors the functional groups and techniques of chemical reactions, in order to introduce this molecule into the cell membrane and alter its potential. 3-Carboxypropanesulfonamide is capable of changing the lipid composition of the membrane by introducing a linker group that can bind with other molecules such as cholesterol or phospholipids. This linker group alters the membrane potential of cells, leading to changes in ion flow and cellular response.
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:167.18 g/mol
Fórmula:C4H9NO4S
Pureza:Min. 95%
Cor/forma:White Powder
InChI:InChI=1S/C4H9NO4S/c5-10(8,9)3-1-2-4(6)7/h1-3H2,(H,6,7)(H2,5,8,9)
Chave InChI:InChIKey=OMPGKWICGUBROA-UHFFFAOYSA-N
SMILES:NS(=O)(=O)CCCC(=O)O
Consulta técnica sobre 3-Carboxypropanesulfonamide
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda. Se desejar solicitar um orçamento ou fazer uma encomenda, por favor, adicione os produtos ao seu carrinho e depois solicite um orçamento ou encomenda a partir do carrinho. É mais rápido, mais barato e poderá beneficiar-se dos descontos e outras vantagens disponíveis.