

Informação sobre produto
Nome:4-Chloro-2-fluorobenzenesulphonyl chloride
Marca:Biosynth
Descrição:4-Chloro-2-fluorobenzenesulphonyl chloride is a chlorinating agent that is used as a catalyst in the synthesis of sulfonyl chlorides. The purity of the product can be improved by recrystallizing it from an acid solution, using a suitable catalyst. This process flow can be synthesized by reacting 4-chloro-2-fluorobenzenesulfonic acid with thionyl chloride in the presence of a base, such as pyridine. The substance is acidic and catalytic, which enables it to react with other substances. 4-Chloro-2-fluorobenzenesulphonyl chloride reacts with ammonia to form ammonium chloride, which is then converted into ammonium sulfate during acidification.
4-Chloro-2-fluorobenzenesulphonyl chloride does not contain chlorine or hydrogen atoms and is not an oxidizer or reducer.
4-Chloro-2-fluorobenzenesulphonyl chloride does not contain chlorine or hydrogen atoms and is not an oxidizer or reducer.
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:229.06 g/mol
Fórmula:C6H3Cl2FO2S
Pureza:Min. 95%
InChI:InChI=1S/C6H3Cl2FO2S/c7-4-1-2-6(5(9)3-4)12(8,10)11/h1-3H
Chave InChI:InChIKey=ZFZRENUEJCOCRE-UHFFFAOYSA-N
SMILES:O=S(=O)(Cl)c1ccc(Cl)cc1F