

Informação sobre produto
Nome:1,4-Cyclohexane-dicarboxylic acid
Marca:Biosynth
Descrição:1,4-Cyclohexane-dicarboxylic acid is a polycarboxylic acid with a cyclohexane ring. It is used as an iron oxide pigment for paints. 1,4-Cyclohexane-dicarboxylic acid is produced by the thermal decomposition of cyclohexanone oxime and can be synthesized in the laboratory using dibutyltin oxide as a catalyst. The molecule has two hydroxyl groups that are involved in steric interactions with other molecules. The chemical structure of 1,4-cyclohexane-dicarboxylic acid consists of a glycol ether and fatty acids, which are responsible for its solubility in organic solvents such as ethers and chlorinated hydrocarbons. FTIR spectroscopy has revealed that 1,4-cyclohexane-dicarboxylic acid contains hydroxyl groups and aromatic rings
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:172.18 g/mol
Fórmula:C8H12O4
Pureza:Min. 95%
InChI:InChI=1S/C8H12O4/c9-7(10)5-1-2-6(4-3-5)8(11)12/h5-6H,1-4H2,(H,9,10)(H,11,12)
Chave InChI:InChIKey=PXGZQGDTEZPERC-UHFFFAOYSA-N
SMILES:O=C(O)C1CCC(C(=O)O)CC1