Informação sobre produto
Nome:2-(4-Chlorophenoxy)aniline
Sinónimos:
- 2-(4-Chlorophenoxy)benzenamine
Marca:Biosynth
Descrição:2-(4-Chlorophenoxy)aniline is a synthetic chemical that is used in the production of triphosgene, an anti-cancer drug. It also has been shown to be a potential candidate for treating malaria and other parasitic diseases. 2-(4-Chlorophenoxy)aniline can be synthesized by reacting chloroformate with an amide in the presence of triphosgene. This reaction leads to the formation of an amide bond between the two reactants. The structure of 2-(4-chlorophenoxy)aniline can be determined using chromatographic methods such as high performance liquid chromatography (HPLC).
2-(4-Chlorophenoxy)aniline has been demonstrated to bind to molecular targets such as carbamates and naphthalenes, which are responsible for bacterial resistance to antibiotics.
2-(4-Chlorophenoxy)aniline has been demonstrated to bind to molecular targets such as carbamates and naphthalenes, which are responsible for bacterial resistance to antibiotics.
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:219.67 g/mol
Fórmula:C12H10ClNO
Pureza:Min. 95%
Cor/forma:Colourless To Reddish Yellow Liquid
InChI:InChI=1S/C12H10ClNO/c13-9-5-7-10(8-6-9)15-12-4-2-1-3-11(12)14/h1-8H,14H2
Chave InChI:InChIKey=QKKBREBZMUFUDS-UHFFFAOYSA-N
SMILES:Nc1ccccc1Oc1ccc(Cl)cc1