

Informação sobre produto
Nome:3-Chloro-4-fluoroacetophenone
Marca:Biosynth
Descrição:3-Chloro-4-fluoroacetophenone is an organic compound with the chemical formula of C6H3ClF. It has a molecular weight of 131.06 g/mol and a melting point at -79 °C. 3-Chloro-4-fluoroacetophenone has a monoclinic crystal structure, with a radiation wavelength range of 0.0 nm to 1.5 nm and an angle range of 2° to 20°
The crystal structure is drawn as follows:
Benzene (C6H6) is the central carbon atom in this molecule, which forms hydrogen bonds with Cl on one side and F on the other side. The hydrogen bonds form the shape of a hexagon around the central benzene molecule, forming six hydrogen bonds in total. The two fluorine atoms are positioned at opposite ends of the hexagon, and are not involved in any hydrogen bonding interactions. The distance between these two fluorine atoms
The crystal structure is drawn as follows:
Benzene (C6H6) is the central carbon atom in this molecule, which forms hydrogen bonds with Cl on one side and F on the other side. The hydrogen bonds form the shape of a hexagon around the central benzene molecule, forming six hydrogen bonds in total. The two fluorine atoms are positioned at opposite ends of the hexagon, and are not involved in any hydrogen bonding interactions. The distance between these two fluorine atoms
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:172.58 g/mol
Fórmula:C8H6ClFO
Pureza:Min. 95%
InChI:InChI=1S/C8H6ClFO/c1-5(11)6-2-3-8(10)7(9)4-6/h2-4H,1H3
Chave InChI:InChIKey=PCJPESKRPOTNGU-UHFFFAOYSA-N
SMILES:CC(=O)c1ccc(F)c(Cl)c1