Informação sobre produto
Nome:3-Chlorobenzyl chloride
Marca:Biosynth
Descrição:3-Chlorobenzyl chloride is an aryl halide that binds to the p. aeruginosa group in the cell membrane and inhibits bacterial growth by inhibiting the synthesis of essential cell components such as proteins, nucleic acids, and lipids. 3-Chlorobenzyl chloride binds to inhibitory molecules on the p. aeruginosa cell surface by covalent bonds or ionic interactions, which prevents these molecules from interacting with other cells. This inhibits the production of functional groups such as chloride ions and cross-coupling reactions. 3-Chlorobenzyl chloride has been shown to have chemical properties that prevent it from being metabolized by microorganisms, which may be due to its resistance to hydrolysis or oxidative metabolism.
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:161.03 g/mol
Fórmula:C7H6Cl2
Pureza:Min. 95%
Cor/forma:Colorless Clear Liquid
InChI:InChI=1S/C7H6Cl2/c8-5-6-2-1-3-7(9)4-6/h1-4H,5H2
Chave InChI:InChIKey=DDGRAFHHXYIQQR-UHFFFAOYSA-N
SMILES:ClCc1cccc(Cl)c1
Consulta técnica sobre 3-Chlorobenzyl chloride
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda. Se desejar solicitar um orçamento ou fazer uma encomenda, por favor, adicione os produtos ao seu carrinho e depois solicite um orçamento ou encomenda a partir do carrinho. É mais rápido, mais barato e poderá beneficiar-se dos descontos e outras vantagens disponíveis.
