Informação sobre produto
Nome:7-Chloroquinaldine
Marca:Biosynth
Descrição:7-Chloroquinaldine is a redox potential that is used in the industrial production of quinoline. It is also used as an intermediate for the synthesis of other organic compounds, such as 7-chloroquinoline and chloroquine. The reaction generally starts with sodium hydroxide solution (NaOH) and pyridine (C5H5N), which react to form sodium pyridinium chloride (NaC5H4N+Cl−). This compound reacts with chloroform (CHCl3) to form 7-chloroquinoline and hydrochloric acid (HCl). The reaction product can be purified by crystallization or by washing with water. A Friedel-Crafts reaction is then conducted using aluminum chloride, which reacts with the 7-chloroquinolone to produce 3,4-dichloropyridine. Finally, this compound reacts with hydrogen peroxide and potassium hydroxide to produce hydrogen chloride
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:177.63 g/mol
Fórmula:C10H8ClN
Pureza:Min. 95%
Cor/forma:Powder
InChI:InChI=1S/C10H8ClN/c1-7-2-3-8-4-5-9(11)6-10(8)12-7/h2-6H,1H3
Chave InChI:InChIKey=WQZQFYRSYLXBGP-UHFFFAOYSA-N
SMILES:Cc1ccc2ccc(Cl)cc2n1
Consulta técnica sobre 7-Chloroquinaldine
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda
Se desejar solicitar um orçamento ou efetuar uma encomenda, adicione, por favor, os produtos pretendidos ao carrinho e faça a gestão do pedido a partir daí. É mais rápido, mais económico e poderá beneficiar dos descontos e das vantagens disponíveis.