

Informação sobre produto
Nome:4-Cyanophenylboronic acid
Marca:Biosynth
Descrição:4-Cyanophenylboronic acid is a boron-containing compound that is used in the synthesis of organic molecules. This chemical has been shown to be used in cross-coupling reactions and Suzuki coupling reactions, which are two types of chemical reactions that involve the formation of covalent bonds between two or more compounds. 4-Cyanophenylboronic acid has also been shown to be used as a non-nucleoside inhibitor of HIV reverse transcriptase, an enzyme that is necessary for the replication of HIV. 4-Cyanophenylboronic acid interacts with other molecules in a reversible manner because it contains both carbon and nitrogen atoms. It can be synthesized from hydrochloric acid and wild-type strain bacteria, which may have clinical applications such as low energy radiation therapy. 4-Cyanophenylboronic acid also has fluorescence properties, which have been analyzed using techniques such as molecular modeling.
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:146.94 g/mol
Fórmula:C7H6BNO2
Pureza:Min. 95%
Cor/forma:Powder
InChI:InChI=1S/H3N/h1H3
Chave InChI:InChIKey=QGZKDVFQNNGYKY-UHFFFAOYSA-N
SMILES:N#Cc1ccc(B(O)O)cc1