Informação sobre produto
Nome:2-Carbomethoxybenzaldehyde
Sinónimos:
- Methyl 2-formylbenzoate2-Carbomethoxybenzaldehyde
Marca:Biosynth
Descrição:2-Carbomethoxybenzaldehyde (2CMB) is a synthetic chemical compound that has been used as an efficient method for the synthesis of amines. The carbonyl group in 2CMB reacts with nucleophiles, such as amines, to form a tetrahydroisoquinoline derivative. This nucleophilic attack leads to the formation of an unstable intermediate that can be isolated and purified by trifluoroacetic acid (TFA). 2CMB is also used in the synthesis of quinoline derivatives and naphthalene derivatives. The acidic properties of 2CMB allow it to react with carboxylic acids, leading to the formation of esters.
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:164.16 g/mol
Fórmula:C9H8O3
Pureza:Min. 95%
Cor/forma:Colorless Powder
InChI:InChI=1S/C9H8O3/c1-12-9(11)8-5-3-2-4-7(8)6-10/h2-6H,1H3
Chave InChI:InChIKey=YRMODRRGEUGHTF-UHFFFAOYSA-N
SMILES:COC(=O)c1ccccc1C=O
Consulta técnica sobre 2-Carbomethoxybenzaldehyde
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda. Se desejar solicitar um orçamento ou fazer uma encomenda, por favor, adicione os produtos ao seu carrinho e depois solicite um orçamento ou encomenda a partir do carrinho. É mais rápido, mais barato e poderá beneficiar-se dos descontos e outras vantagens disponíveis.