

Informação sobre produto
Nome:2-Chloro-6-ethoxypyridine
Marca:Biosynth
Descrição:2-Chloro-6-ethoxypyridine is an amination reaction intermediate that is used as a penetrant. It reacts with hydrochloric acid to form 2-chloro-6-(ethylthio)pyridine, which then reacts with nucleophilic reagents such as piperazine to produce the desired end product. The terminal half-life of 2-chloro-6-ethoxypyridine is about 1 hour in humans. This compound can be analyzed using analytical methods such as gas chromatography and mass spectrometry.
2-Chloro-6-ethoxypyridine is also a reaction product of pyrimidine derivatives and anions, which can be synthesized by reacting aniline with ketones or amides.
2-Chloro-6-ethoxypyridine is also a reaction product of pyrimidine derivatives and anions, which can be synthesized by reacting aniline with ketones or amides.
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:157.6 g/mol
Fórmula:C7H8ClNO
Pureza:Min. 95%
InChI:InChI=1S/C7H8ClNO/c1-2-10-7-5-3-4-6(8)9-7/h3-5H,2H2,1H3
Chave InChI:InChIKey=AMSLPXHLKHZWBJ-UHFFFAOYSA-N
SMILES:CCOc1cccc(Cl)n1