

Informação sobre produto
Nome:2,3-Dimethylpyridin-4-amine
Marca:Biosynth
Descrição:2,3-Dimethylpyridin-4-amine is an aliphatic compound that has been used as a fingerprinting agent in forensic investigations. It reacts with fatty acids to produce choline and aliphatic chains of different lengths, which are then analyzed by chromatographic techniques. 2,3-Dimethylpyridin-4-amine can be detected using mass spectrometry because it has a molecular weight of 122 amu. The electrospray ionization technique is used to generate the positive ions that are analyzed by mass spectrometry. This technique uses an electric field to produce ions from the sample placed in an electrospray ion source. Electrospray ionization mass spectroscopy can distinguish between molecules with similar masses, such as 2,3-dimethylpyridin-4-amine and 1-(2,6-dimethoxyphenyl)-2-(2,6-dimethoxybenzyl
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:122.17 g/mol
Fórmula:C7H10N2
Pureza:Min. 95%
InChI:InChI=1S/C7H10N2/c1-5-6(2)9-4-3-7(5)8/h3-4H,1-2H3,(H2,8,9)
Chave InChI:InChIKey=YHUUZKCUQVILTK-UHFFFAOYSA-N
SMILES:Cc1nccc(N)c1C