
1,3-Dihydroxy-2-naphthoic acid
CAS:
Ref. 3D-FD154238

Informação sobre produto
Nome:1,3-Dihydroxy-2-naphthoic acid
Marca:Biosynth
Descrição:1,3-Dihydroxy-2-naphthoic acid is an organic compound that belongs to the binaphthyls. It is a white solid that can be obtained by reacting naphthalene with inorganic phosphite in the presence of acidic potassium carbonate. This reaction system produces 1,3-dihydroxy-2-naphthoic acid and potassium biphosphite as byproducts. The reaction time depends on the concentration of reactants. 1,3-Dihydroxy-2-naphthoic acid has acidic properties and can be used as a catalyst for chemical reactions involving carboxylic compounds. This compound has been shown to be effective at treating abdominal pain caused by intestinal inflammation or infection with a carbon source such as carbohydrates (e.g., glucose) or fats (e.g., oleic acid).
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:204.18 g/mol
Fórmula:C11H8O4
Pureza:Min. 95%
InChI:InChI=1S/C11H8O4/c12-8-5-6-3-1-2-4-7(6)10(13)9(8)11(14)15/h1-5,12-13H,(H,14,15)
Chave InChI:InChIKey=USZZLTVYRPLBMB-UHFFFAOYSA-N
SMILES:O=C(O)c1c(O)cc2ccccc2c1O