

Informação sobre produto
Nome:1,3-Diaminocyclohexane
Marca:Biosynth
Descrição:1,3-Diaminocyclohexane (1,3-DAC) is a colorless liquid that is soluble in water. It has a molecular mass of 104.09 g/mol and a molar mass of 153.2 g/mol. 1,3-DAC is used as an intermediate for the synthesis of other chemicals such as polymerized 1,3-DAC, which is used as sealant or monomer in the production of polyurethanes. 1,3-DAC can be polymerized to form linear polymers with diamines such as ethylenediamine (EDA) or hexamethylenediamine (HMDA). 1,3-DAC can also be dehydrated to produce triethyl orthoformate by reacting with an alcohol and then heated in presence of air. The dehydration process forms a cyclic compound that contains three carbon atoms connected to each other in a circular structure with one oxygen atom and
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:114.19 g/mol
Fórmula:C6H14N2
Pureza:Min. 95%
InChI:InChI=1S/C6H14N2/c7-5-2-1-3-6(8)4-5/h5-6H,1-4,7-8H2
Chave InChI:InChIKey=GEQHKFFSPGPGLN-UHFFFAOYSA-N
SMILES:NC1CCCC(N)C1