Informação sobre produto
- Ethanamine, N-chloro-N-ethyl-
- N-Chloro-N-ethylethanamine
N,N-Diethylchloramine is a chemical compound that belongs to the group of chloramines. It is an alkylating agent that reacts with the chloride ion to form N,N-diethylchloramine chloride (DEAC). The reaction mechanism is based on the formation of a nucleophilic chlorine atom and an electrophilic nitrogen atom. DEAC has been used as an analytical method for determining chloride levels in wastewater. This chemical also has toxicological studies which show that it can be fatal if inhaled or ingested in large quantities. The molecular formula for DEAC is CHClNOCHCHClNOCHClNOCHClNOCHClNOCHClNOCHC(O)NH.
Propriedades químicas
Consulta técnica sobre: 3D-FD170412 N,N-Diethylchloramine
Se desejar solicitar um orçamento ou fazer uma encomenda, por favor, adicione os produtos ao seu carrinho e depois solicite um orçamento ou encomenda a partir do carrinho. É mais rápido, mais barato e poderá beneficiar-se dos descontos e outras vantagens disponíveis.