Informação sobre produto
Nome:4-Dimethylaminocinnamic acid
Marca:Biosynth
Descrição:4-Dimethylaminocinnamic acid (DMA) is a natural organic compound found in plants and animals. This compound has been studied for its potential use as a drug, but it is not currently used in medicine. 4-Dimethylaminocinnamic acid can inhibit the activity of certain enzymes by binding to them, including the enzyme polymerase chain that synthesizes DNA. It also can bind to other proteins, such as carbonyl groups and cinnamic acid derivatives, which are found in human liver cells. 4-Dimethylaminocinnamic acid can form hydrogen bonds with other molecules due to its hydroxyl group and carboxylic acid group. It also has a high viscosity due to its long hydrocarbon chain.
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:191.23 g/mol
Fórmula:C11H13NO2
Pureza:Min. 95%
Cor/forma:Powder
InChI:InChI=1S/C11H13NO2/c1-12(2)10-6-3-9(4-7-10)5-8-11(13)14/h3-8H,1-2H3,(H,13,14)/b8-5+
Chave InChI:InChIKey=CQNPVMCASGWEHM-VMPITWQZSA-N
SMILES:CN(C)c1ccc(/C=C/C(=O)O)cc1
Consulta técnica sobre 4-Dimethylaminocinnamic acid
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda. Se desejar solicitar um orçamento ou fazer uma encomenda, por favor, adicione os produtos ao seu carrinho e depois solicite um orçamento ou encomenda a partir do carrinho. É mais rápido, mais barato e poderá beneficiar-se dos descontos e outras vantagens disponíveis.
