Informação sobre produto
Nome:a, a-Dimethyl 3-isopropenylbenzyl isocyanate
Marca:Biosynth
Descrição:3-Isopropenylbenzyl isocyanate is a functional monomer that is used in the polymerization process. It reacts with styrene to form polymers and has reactive groups that can be used for cross-linking. 3-Isopropenylbenzyl isocyanate has a primary amino group and an aliphatic chain of 3 carbon atoms, which can be reacted with other molecules to form new compounds. The compound exists as a colorless liquid at room temperature and has a crystallization process that involves radiation or peroxide. This chemical can also be used as an additive for size-exclusion chromatography to increase the resolution of small molecules.
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:201.26 g/mol
Fórmula:C13H15NO
Pureza:Min. 95%
InChI:InChI=1S/C13H15NO/c1-10(2)11-6-5-7-12(8-11)13(3,4)14-9-15/h5-8H,1H2,2-4H3
Chave InChI:InChIKey=ZVEMLYIXBCTVOF-UHFFFAOYSA-N
SMILES:C=C(C)c1cccc(C(C)(C)N=C=O)c1