Informação sobre produto
Nome:Dimethyl acetylmethylphosphonate
Marca:Biosynth
Descrição:Dimethyl acetylmethylphosphonate is a chlorinated organocatalytic reagent that is used in the Friedel-Crafts reaction. It can be used as an acceptor in the synthesis of pharmaceutical formulations and has been shown to react with chloride, triethyl orthoformate, 4-acetamidobenzenesulfonyl azide, β-unsaturated ketone, hexahydrate, trifluoromethanesulfonic acid, c1-4 alkyl aldehydes, and phosphonates.
The Friedel-Crafts reaction is an organic reaction that involves the conversion of an unsaturated compound into another compound with more double bonds by adding a hydrogen atom to one of the carbons in the molecule. This process can be used for many purposes such as creating drugs or other chemicals. Dimethyl acetylmethylphosphonate is an example of a chemical that can be synthesized using this reaction.
The Friedel-Crafts reaction is an organic reaction that involves the conversion of an unsaturated compound into another compound with more double bonds by adding a hydrogen atom to one of the carbons in the molecule. This process can be used for many purposes such as creating drugs or other chemicals. Dimethyl acetylmethylphosphonate is an example of a chemical that can be synthesized using this reaction.
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:166.11 g/mol
Fórmula:C5H11O4P
Pureza:Min. 95%
Cor/forma:Colourless To Yellow To Light Brown Liquid
InChI:InChI=1S/C5H11O4P/c1-5(6)4-10(7,8-2)9-3/h4H2,1-3H3
Chave InChI:InChIKey=UOWIYNWMROWVDG-UHFFFAOYSA-N
SMILES:COP(=O)(CC(C)=O)OC