Informação sobre produto
Nome:3,5-Dihydroxybenzamide
Marca:Biosynth
Descrição:3,5-Dihydroxybenzamide is an amide derivative that has anticancer activity. This compound inhibits the growth of C. glabrata by inhibiting protein synthesis in the mitochondria and DNA replication in the nucleus. 3,5-Dihydroxybenzamide also inhibits the growth of cancer cells by binding to a molecule that is involved in cancer cell proliferation. The inhibitor molecule binds to a specific site on the molecule, preventing it from forming new cancer cells. The mechanism of action for this compound is not known, but may be due to its ability to bind with chloride ions or its ability to form supramolecular chemistry with other molecules.
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:153.14 g/mol
Fórmula:C7H7NO3
Pureza:Min. 95%
Cor/forma:Powder
InChI:InChI=1S/C7H7NO3/c8-7(11)4-1-5(9)3-6(10)2-4/h1-3,9-10H,(H2,8,11)
Chave InChI:InChIKey=PLYYMFBDRBSPJZ-UHFFFAOYSA-N
SMILES:NC(=O)c1cc(O)cc(O)c1
Consulta técnica sobre 3,5-Dihydroxybenzamide
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda. Se desejar solicitar um orçamento ou fazer uma encomenda, por favor, adicione os produtos ao seu carrinho e depois solicite um orçamento ou encomenda a partir do carrinho. É mais rápido, mais barato e poderá beneficiar-se dos descontos e outras vantagens disponíveis.
