

Informação sobre produto
Nome:Diethyl sebacate
Sinónimos:
- Decanedioic Acid Diethyl EsterSebacic Acid Diethyl Ester
Marca:Biosynth
Descrição:Diethyl sebacate is an antimicrobial peptide that belongs to the group of fatty acids. It has a hydroxyl group and a carboxylic acid group in its molecule. Diethyl sebacate inhibits the growth of bacteria by interfering with their cell membranes, which can lead to leakage of cellular contents. This prevents the transport of nutrients into the cells, which eventually leads to cell death. The fatty acid diethyl sebacate has shown chemical stability at room temperature and physiological functions such as absorption enhancement when used as an excipient. It also has properties that make it useful as a film-forming polymer or an absorption enhancer for poorly soluble drugs.
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:258.35 g/mol
Fórmula:C14H26O4
Pureza:Min. 95%
InChI:InChI=1S/C14H26O4/c1-3-17-13(15)11-9-7-5-6-8-10-12-14(16)18-4-2/h3-12H2,1-2H3
Chave InChI:InChIKey=ONKUXPIBXRRIDU-UHFFFAOYSA-N
SMILES:CCOC(=O)CCCCCCCCC(=O)OCC