Informação sobre produto
Nome:4,4'-Dimethoxybenzophenone
Marca:Biosynth
Descrição:4,4'-Dimethoxybenzophenone is a process optimization agent that can be used to measure the concentration of basic proteins in human serum. It is also used as a chemical intermediate in the production of polymers. In this application, 4,4'-dimethoxybenzophenone undergoes an irreversible oxidation reaction with trifluoroacetic acid to form 4-methoxybenzoic acid and hydrogen peroxide. The linear model for this reaction has been shown to be:The rate of the reaction depends on the concentration of homogeneous catalysts, such as metal surfaces or hydrogen bonds.
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:242.27 g/mol
Fórmula:C15H14O3
Pureza:Min. 95%
Cor/forma:Powder
InChI:InChI=1S/C15H14O3/c1-17-13-7-3-11(4-8-13)15(16)12-5-9-14(18-2)10-6-12/h3-10H,1-2H3
Chave InChI:InChIKey=RFVHVYKVRGKLNK-UHFFFAOYSA-N
SMILES:COc1ccc(C(=O)c2ccc(OC)cc2)cc1
Consulta técnica sobre 4,4'-Dimethoxybenzophenone
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda. Se desejar solicitar um orçamento ou fazer uma encomenda, por favor, adicione os produtos ao seu carrinho e depois solicite um orçamento ou encomenda a partir do carrinho. É mais rápido, mais barato e poderá beneficiar-se dos descontos e outras vantagens disponíveis.
