Informação sobre produto
Nome:4,4'-Dimethoxybenzophenone
Marca:Biosynth
Descrição:4,4'-Dimethoxybenzophenone is a process optimization agent that can be used to measure the concentration of basic proteins in human serum. It is also used as a chemical intermediate in the production of polymers. In this application, 4,4'-dimethoxybenzophenone undergoes an irreversible oxidation reaction with trifluoroacetic acid to form 4-methoxybenzoic acid and hydrogen peroxide. The linear model for this reaction has been shown to be:
The rate of the reaction depends on the concentration of homogeneous catalysts, such as metal surfaces or hydrogen bonds.
The rate of the reaction depends on the concentration of homogeneous catalysts, such as metal surfaces or hydrogen bonds.
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:242.27 g/mol
Fórmula:C15H14O3
Pureza:Min. 95%
Cor/forma:Powder
InChI:InChI=1S/C15H14O3/c1-17-13-7-3-11(4-8-13)15(16)12-5-9-14(18-2)10-6-12/h3-10H,1-2H3
Chave InChI:InChIKey=RFVHVYKVRGKLNK-UHFFFAOYSA-N
SMILES:COc1ccc(C(=O)c2ccc(OC)cc2)cc1
Consulta técnica sobre 4,4'-Dimethoxybenzophenone
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda. Se desejar solicitar um orçamento ou fazer uma encomenda, por favor, adicione os produtos ao seu carrinho e depois solicite um orçamento ou encomenda a partir do carrinho. É mais rápido, mais barato e poderá beneficiar-se dos descontos e outras vantagens disponíveis.