Informação sobre produto
Nome:2,5-Difluorobenzoic acid
Marca:Biosynth
Descrição:2,5-Difluorobenzoic acid is a coordination compound that can be used as a reference standard for analytical methods. It is also used in the synthesis of other coordination compounds and has been shown to have anticancer activity. 2,5-Difluorobenzoic acid is prepared by treating 2,5-dichlorobenzoic acid with sodium borohydride in methanol. The molecule has a nitrogen atom at the center, which coordinates to two chloride ions and one proton. The proton is coordinated to the nitrogen atom through a hydrogen bond and the chloride ions are coordinated through a dative bond. This compound can be analyzed using an LC-MS/MS method that is able to distinguish between structural analogs of 2,5-difluorobenzoic acid based on differences in their mass spectra.
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:158.1 g/mol
Fórmula:C7H4F2O2
Pureza:Min. 95%
InChI:InChI=1S/C7H4F2O2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3H,(H,10,11)
Chave InChI:InChIKey=LBQMIAVIGLLBGW-UHFFFAOYSA-N
SMILES:O=C(O)c1cc(F)ccc1F
Consulta técnica sobre 2,5-Difluorobenzoic acid
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda. Se desejar solicitar um orçamento ou fazer uma encomenda, por favor, adicione os produtos ao seu carrinho e depois solicite um orçamento ou encomenda a partir do carrinho. É mais rápido, mais barato e poderá beneficiar-se dos descontos e outras vantagens disponíveis.