Informação sobre produto
Nome:Daphnoretin
Sinónimos:
- ThymelolEdgeworthin-6-methyl ether
Marca:Biosynth
Descrição:Daphnoretin is a naturally occurring lignan, which is a type of product derived from plant sources, particularly species of the genus Daphne. It is characterized by its complex chemical structure and is known for its potential bioactive properties. The mode of action of daphnoretin involves modulating various cellular pathways, including those related to apoptosis and oxidative stress, through its interaction with cellular receptors and enzymes. This modulation can lead to either the inhibition or activation of specific cellular processes, which is of significant interest in scientific research.
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:352.29 g/mol
Fórmula:C19H12O7
Pureza:Min. 95%
Cor/forma:Powder
InChI:InChI=1S/C19H12O7/c1-23-16-6-11-7-17(19(22)26-15(11)9-13(16)20)24-12-4-2-10-3-5-18(21)25-14(10)8-12/h2-9,20H,1H3
Chave InChI:InChIKey=JRHMMVBOTXEHGJ-UHFFFAOYSA-N
SMILES:COc1cc2cc(Oc3ccc4ccc(=O)oc4c3)c(=O)oc2cc1O
Consulta técnica sobre Daphnoretin
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda. Se desejar solicitar um orçamento ou fazer uma encomenda, por favor, adicione os produtos ao seu carrinho e depois solicite um orçamento ou encomenda a partir do carrinho. É mais rápido, mais barato e poderá beneficiar-se dos descontos e outras vantagens disponíveis.