Informação sobre produto
Nome:3,2'-Dimethoxyflavone
Marca:Biosynth
Descrição:3,2'-Dimethoxyflavone is a specialized type of naturally occurring flavone, which is commonly derived from various plant sources such as leaves, stems, and roots. As a flavonoid compound, it is part of a larger class of polyphenolic substances known for their diverse biological activities. The mode of action of 3,2'-Dimethoxyflavone primarily involves its interaction with cellular oxidative pathways, where it exhibits potential antioxidant properties. Additionally, it may act as an enzyme inhibitor, possibly affecting pathways tied to signal transduction and metabolism.
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:282.29 g/mol
Fórmula:C17H14O4
Pureza:Min. 95%
InChI:InChI=1S/C17H14O4/c1-19-13-9-5-4-8-12(13)16-17(20-2)15(18)11-7-3-6-10-14(11)21-16/h3-10H,1-2H3
Chave InChI:InChIKey=SJZIKJCJJAPNQI-UHFFFAOYSA-N
SMILES:COc1ccccc1-c1oc2ccccc2c(=O)c1OC
Consulta técnica sobre 3,2'-Dimethoxyflavone
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda. Se desejar solicitar um orçamento ou fazer uma encomenda, por favor, adicione os produtos ao seu carrinho e depois solicite um orçamento ou encomenda a partir do carrinho. É mais rápido, mais barato e poderá beneficiar-se dos descontos e outras vantagens disponíveis.