

Informação sobre produto
Nome:Ethyl 2-methylacetoacetate
Sinónimos:
- 2-Methyl-3-oxo-butanoic acid ethyl esterα-Methyl-acetoacetic acid ethyl ester2-Methyl-3-oxobutanoic acid ethyl ester
Marca:Biosynth
Descrição:Ethyl 2-methylacetoacetate is an organic compound with the formula CH3COOC2H5. It is a colorless liquid that is soluble in water and alcohols. Ethyl 2-methylacetoacetate has been shown to have antiinflammatory activity and can be used to treat HIV infections. The transport rate of ethyl 2-methylacetoacetate has been shown to be higher than other esters, such as ethyl acetoacetate. Acetylation reactions are typically catalyzed by acid or base, but the reaction mechanism of this compound has not yet been elucidated. X-ray crystal structures show that ethyl 2-methylacetoacetate reacts with basic proteins such as sodium carbonate, leading to cell lysis.
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:144.17 g/mol
Fórmula:C7H12O3
Pureza:Min. 98 Area-%
Cor/forma:Colorless Clear Liquid
InChI:InChI=1S/C7H12O3/c1-4-10-7(9)5(2)6(3)8/h5H,4H2,1-3H3
Chave InChI:InChIKey=FNENWZWNOPCZGK-UHFFFAOYSA-N
SMILES:CCOC(=O)C(C)C(C)=O