

Informação sobre produto
Nome:Ethyl 4,4,4-trifluorobutyrate
Marca:Biosynth
Descrição:Ethyl 4,4,4-trifluorobutyrate is a difluoroacetate salt that can be used as an electrolyte in rechargeable batteries. It has a layered structure and is bifunctional, with an alkyl moiety on one end and a carboxylate group on the other. The transition metal ions are required for the reaction to proceed. When heated, ethyl 4,4,4-trifluorobutyrate decomposes into ethanol and hydrogen fluoride gas. This compound also exhibits good solubility in organic solvents such as ethers and esters. The reaction is exothermic and occurs at temperatures below 100 °C when ethyl 4,4,4-trifluorobutyrate is dissolved in nonpolar solvents such as hexane or heptane.
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:170.13 g/mol
Fórmula:C6H9F3O2
Pureza:Min. 95%
InChI:InChI=1S/C6H9F3O2/c1-2-11-5(10)3-4-6(7,8)9/h2-4H2,1H3
Chave InChI:InChIKey=PSRZMXNNQTWAGB-UHFFFAOYSA-N
SMILES:CCOC(=O)CCC(F)(F)F