Informação sobre produto
Nome:Fast Violet B - Dye content 85%
Sinónimos:
- N-(4-Amino-5-methoxy-2-methylphenyl)-benzamide
Marca:Biosynth
Descrição:Fast Violet B is a diazonium salt that reacts with an amine, such as phosphatase, to release hydrogen. This reaction can be used to measure the activity of phosphatases. The emission of light in the visible range depends on the concentration and pH of the solution. Fast Violet B is soluble in water, alcohol, acetone, ether and chloroform. It has a particle size that ranges from 0.1-0.2 microns in diameter and will not dissolve in most solvents. Fast Violet B can be used to detect zearalenone in animal feed samples using a sample preparation technique called thin layer chromatography (TLC). It has shown clinical utility for determining antibody response in humans by measuring fatty acid synthesis activity during the inflammatory response. Fast Violet B also reacts with hydrogen bonds between nucleotides on DNA molecules and it binds to human mitochondrial DNA because it contains many phosphate groups and several intramolecular hydrogen bonds can form between neighboring
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:256.3 g/mol
Fórmula:C15H16N2O2
Pureza:Min. 95%
Cor/forma:Powder
InChI:InChI=1S/C15H16N2O2/c1-10-8-12(16)14(19-2)9-13(10)17-15(18)11-6-4-3-5-7-11/h3-9H,16H2,1-2H3,(H,17,18)
Chave InChI:InChIKey=VENDXQNWODZJGB-UHFFFAOYSA-N
SMILES:COc1cc(NC(=O)c2ccccc2)c(C)cc1N
Consulta técnica sobre Fast Violet B - Dye content 85%
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda. Se desejar solicitar um orçamento ou fazer uma encomenda, por favor, adicione os produtos ao seu carrinho e depois solicite um orçamento ou encomenda a partir do carrinho. É mais rápido, mais barato e poderá beneficiar-se dos descontos e outras vantagens disponíveis.
