
4-Fluorophthalic acid
CAS:
Ref. 3D-FF68061

Informação sobre produto
Nome:4-Fluorophthalic acid
Sinónimos:
- 4-Fluorobenzene-1,2-dicarboxylic acid
Marca:Biosynth
Descrição:4-Fluorophthalic acid is a monomer that forms polymers with high molecular weights. 4-Fluorophthalic acid is soluble in water and has been shown to be effective as a disinfectant. It has also been shown to have strong antifungal activity against Candida albicans and other species of yeast, due to its ability to penetrate the cell wall. Fluorinated surfaces have been shown to have increased resistance to bacterial colonization, which may be due to an increase in surface wettability or the formation of a fluorocarbon film on the surface. 4-Fluorophthalic acid can be used for the production of covid-19 (pandemic influenza vaccine), which is a vaccine that contains small quantities of 4-fluorophthalic acid, making it more stable during storage. The presence of this molecule makes it possible for Covid-19 vaccines to be safely stored at room temperature without refrigeration
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:184.12 g/mol
Fórmula:C8H5FO4
Pureza:Min. 95%
Cor/forma:White Powder
InChI:InChI=1S/C8H5FO4/c9-4-1-2-5(7(10)11)6(3-4)8(12)13/h1-3H,(H,10,11)(H,12,13)
Chave InChI:InChIKey=OMCXTFVBNCFZMY-UHFFFAOYSA-N
SMILES:O=C(O)c1ccc(F)cc1C(=O)O