
3-Formylbenzyl alcohol
CAS:
Ref. 3D-FF69891

Informação sobre produto
Nome:3-Formylbenzyl alcohol
Sinónimos:
- 3-(Hydroxymethyl)benzaldehyde
Marca:Biosynth
Descrição:3-Formylbenzyl alcohol is a fatty acid that has been shown to inhibit the growth of bacteria by binding to the hydroxyl group of the bacterial cell membrane. 3-Formylbenzyl alcohol's antimicrobial activity is due to its ability to inhibit the production of fatty acids in the cell membrane, preventing the formation of an outer layer that protects bacteria from attack. The antibacterial agent also inhibits protein synthesis and prevents DNA replication, resulting in cell death. 3-Formylbenzyl alcohol binds to bacteria through hydrogen bonding and has been shown to be effective against Staphylococcus aureus, Bacillus subtilis, Escherichia coli, and Pseudomonas aeruginosa. The mechanism for this action is not clear but may involve an intramolecular hydrogen bond or nucleophilic attack by one of its carbonyl groups on a nitrogen atom in the bacterial molecule.
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:136.15 g/mol
Fórmula:C8H8O2
Pureza:Min. 95%
Cor/forma:Off-White Powder
InChI:InChI=1S/C8H8O2/c9-5-7-2-1-3-8(4-7)6-10/h1-5,10H,6H2
Chave InChI:InChIKey=CDNQOMJEQKBLBN-UHFFFAOYSA-N
SMILES:O=Cc1cccc(CO)c1