Informação sobre produto
Nome:2-Hydroxy-6-methoxybenzaldehyde
Marca:Biosynth
Descrição:2-Hydroxy-6-methoxybenzaldehyde is a molecule that can form hydrogen bonds with other molecules. FT-IR spectroscopy has shown that this compound has a copper complex and an acidic proton, which may be due to intramolecular hydrogen bonding interactions. The compound also has been shown to have potent inhibitory activity against cellular growth and cancer cells in vitro. 2-Hydroxy-6-methoxybenzaldehyde is a metal chelator and can therefore bind to metals such as iron and copper. It is genotoxic, which means it damages DNA by causing DNA strand breaks or crosslinks, leading to cell death. This chemical may also cause genetic mutations through the formation of tautomers that make DNA replication difficult. Gel chromatography shows that 2HMB has a low molecular weight (MW) and high solubility.
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:152.15 g/mol
Fórmula:C8H8O3
Pureza:Min. 95%
Cor/forma:Powder
InChI:InChI=1S/C8H8O3/c1-11-8-4-2-3-7(10)6(8)5-9/h2-5,10H,1H3
Chave InChI:InChIKey=DZJPDDVDKXHRLF-UHFFFAOYSA-N
SMILES:COc1cccc(O)c1C=O
Consulta técnica sobre 2-Hydroxy-6-methoxybenzaldehyde
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda
Se desejar solicitar um orçamento ou efetuar uma encomenda, adicione, por favor, os produtos pretendidos ao carrinho e faça a gestão do pedido a partir daí. É mais rápido, mais económico e poderá beneficiar dos descontos e das vantagens disponíveis.